Products 2098126-02-2
CAS 2098126-02-2 is the registry number for 8,8-Difluoro-1-azaspiro(4.5)decane hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
8,8-difluoro-1-azaspiro[4.5]decane;hydrochloride (CAS 2098126-02-2) is a chemical compound with the molecular formula C9H16ClF2N and a molecular weight of 211.68 g/mol. IUPAC name: 8,8-difluoro-1-azaspiro[4.5]decane;hydrochloride. InChIKey: GHVXUPUPTDACGN-UHFFFAOYSA-N.
| Molecular formula | C9H16ClF2N |
|---|---|
| Molecular weight | 211.68 g/mol |
| IUPAC name | 8,8-difluoro-1-azaspiro[4.5]decane;hydrochloride |
| InChIKey | GHVXUPUPTDACGN-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC(CC2)(F)F)NC1.Cl |
Computed by PubChem (NCBI)