CAS 2791272-40-5 is the registry number for 2,2-Difluoro-7-azaspiro[4.5]decane hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,3-difluoro-7-azaspiro[4.5]decane;hydrochloride (CAS 2791272-40-5) is a chemical compound with the molecular formula C9H16ClF2N and a molecular weight of 211.68 g/mol. IUPAC name: 3,3-difluoro-7-azaspiro[4.5]decane;hydrochloride. InChIKey: FJENCUBKDZSRKX-UHFFFAOYSA-N.
| Molecular formula | C9H16ClF2N |
|---|---|
| Molecular weight | 211.68 g/mol |
| IUPAC name | 3,3-difluoro-7-azaspiro[4.5]decane;hydrochloride |
| InChIKey | FJENCUBKDZSRKX-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC(C2)(F)F)CNC1.Cl |
Computed by PubChem (NCBI)