Products 2305251-81-2
CAS 2305251-81-2 is the registry number for 7,7-Difluorospiro(3.5)nonan-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7,7-difluorospiro[3.5]nonan-2-amine;hydrochloride (CAS 2305251-81-2) is a chemical compound with the molecular formula C9H16ClF2N and a molecular weight of 211.68 g/mol. IUPAC name: 7,7-difluorospiro[3.5]nonan-2-amine;hydrochloride. InChIKey: PXJSHMOSHHDBEA-UHFFFAOYSA-N.
| Molecular formula | C9H16ClF2N |
|---|---|
| Molecular weight | 211.68 g/mol |
| IUPAC name | 7,7-difluorospiro[3.5]nonan-2-amine;hydrochloride |
| InChIKey | PXJSHMOSHHDBEA-UHFFFAOYSA-N |
| SMILES | C1CC(CCC12CC(C2)N)(F)F.Cl |
Computed by PubChem (NCBI)