CAS 2098425-82-0 is the registry number for [2-Ethoxy-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
[2-ethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol (CAS 2098425-82-0) is a chemical compound with the molecular formula C15H23BO4 and a molecular weight of 278.15 g/mol. IUPAC name: [2-ethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol. InChIKey: WGBLSCARYWVBMN-UHFFFAOYSA-N.
| Molecular formula | C15H23BO4 |
|---|---|
| Molecular weight | 278.15 g/mol |
| IUPAC name | [2-ethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol |
| InChIKey | WGBLSCARYWVBMN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)CO)OCC |
Computed by PubChem (NCBI)