Products 2927398-65-8
CAS 2927398-65-8 is the registry number for 2-Isopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,3-diol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,3-diol (CAS 2927398-65-8) is a chemical compound with the molecular formula C15H23BO4 and a molecular weight of 278.15 g/mol. IUPAC name: 2-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,3-diol. InChIKey: BEOMFKHHUJPKTE-UHFFFAOYSA-N.
| Molecular formula | C15H23BO4 |
|---|---|
| Molecular weight | 278.15 g/mol |
| IUPAC name | 2-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,3-diol |
| InChIKey | BEOMFKHHUJPKTE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)O)C(C)C)O |
Computed by PubChem (NCBI)