CAS 959972-43-1 appears in our catalog under these names: 2-[3-(2-methoxyethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 2-(3-(2-Methoxyethoxy)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95-<97%. Offered by: Combi-blocks, Hoffman Fine Chemicals. Available pack sizes: 250mg, 5g, 1g, 10g, 25g, 50g, 100g, 200g.
2-[3-(2-methoxyethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 959972-43-1) is a chemical compound with the molecular formula C15H23BO4 and a molecular weight of 278.15 g/mol. IUPAC name: 2-[3-(2-methoxyethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: WWVRGGSYMUIJJQ-UHFFFAOYSA-N.
| Molecular formula | C15H23BO4 |
|---|---|
| Molecular weight | 278.15 g/mol |
| IUPAC name | 2-[3-(2-methoxyethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | WWVRGGSYMUIJJQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)OCCOC |
Computed by PubChem (NCBI)