Products 2098426-70-9
CAS 2098426-70-9 is the registry number for 3-Methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole, 97%, 97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
3-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole (CAS 2098426-70-9) is a chemical compound with the molecular formula C14H19BN2O3 and a molecular weight of 274.13 g/mol. IUPAC name: 3-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole. InChIKey: QGQQBYPZJKAVFU-UHFFFAOYSA-N.
| Molecular formula | C14H19BN2O3 |
|---|---|
| Molecular weight | 274.13 g/mol |
| IUPAC name | 3-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole |
| InChIKey | QGQQBYPZJKAVFU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C(=NN3)OC |
Computed by PubChem (NCBI)