CAS 209846-22-0 appears in our catalog under these names: (Z)-2-Fluoro-3-(pyridin-2-yl)acrylic acid, 98%, 98%, (Z)-2-Fluoro-3-(pyridin-2-yl)acrylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(Z)-2-fluoro-3-pyridin-2-ylprop-2-enoic acid (CAS 209846-22-0) is a chemical compound with the molecular formula C8H6FNO2 and a molecular weight of 167.14 g/mol. IUPAC name: (Z)-2-fluoro-3-pyridin-2-ylprop-2-enoic acid. InChIKey: NBNXXHVOWIXISR-ALCCZGGFSA-N.
| Molecular formula | C8H6FNO2 |
|---|---|
| Molecular weight | 167.14 g/mol |
| IUPAC name | (Z)-2-fluoro-3-pyridin-2-ylprop-2-enoic acid |
| InChIKey | NBNXXHVOWIXISR-ALCCZGGFSA-N |
| SMILES | C1=CC=NC(=C1)/C=C(/C(=O)O)\F |
Computed by PubChem (NCBI)