Products 2098563-70-1
CAS 2098563-70-1 appears in our catalog under these names: Fluorescent probe QG–1, 3-(4-Oxo-1H-quinazolin-2-yl)-N-((1S)-1-phenylethyl)propanamide. Offered by: GLPBio, Biosynth. Available pack sizes: 10mg, 50mg, 100mg.
(E)-2-cyano-3-[7-(diethylamino)-2-oxochromen-3-yl]-N,N-dimethylprop-2-enamide (CAS 2098563-70-1) is a chemical compound with the molecular formula C19H21N3O3 and a molecular weight of 339.4 g/mol. IUPAC name: (E)-2-cyano-3-[7-(diethylamino)-2-oxochromen-3-yl]-N,N-dimethylprop-2-enamide. InChIKey: BWLQRALTRQXGBI-XNTDXEJSSA-N.
| Molecular formula | C19H21N3O3 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | (E)-2-cyano-3-[7-(diethylamino)-2-oxochromen-3-yl]-N,N-dimethylprop-2-enamide |
| InChIKey | BWLQRALTRQXGBI-XNTDXEJSSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C=C(C(=O)O2)/C=C(\C#N)/C(=O)N(C)C |
Computed by PubChem (NCBI)