Products 338770-89-1
CAS 338770-89-1 is the registry number for 1-(2-(2-Nitroethyl)benzoyl)-4-phenylpiperazine. Offered by: Biosynth. Available pack sizes: 1000mg.
[2-(2-nitroethyl)phenyl]-(4-phenylpiperazin-1-yl)methanone (CAS 338770-89-1) is a chemical compound with the molecular formula C19H21N3O3 and a molecular weight of 339.4 g/mol. IUPAC name: [2-(2-nitroethyl)phenyl]-(4-phenylpiperazin-1-yl)methanone. InChIKey: QJTIWHYHHQCCKZ-UHFFFAOYSA-N.
| Molecular formula | C19H21N3O3 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | [2-(2-nitroethyl)phenyl]-(4-phenylpiperazin-1-yl)methanone |
| InChIKey | QJTIWHYHHQCCKZ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=CC=CC=C2)C(=O)C3=CC=CC=C3CC[N+](=O)[O-] |
Computed by PubChem (NCBI)