Products 791587-67-2
CAS 791587-67-2 appears in our catalog under these names: cFMS–IN–2, cFMS-IN-2, c-Fms-IN-2, 99.79%, c-Fms-IN-2, 99%, 5-Cyano-N-(5-(hydroxymethyl)-2-(4-methylpiperidin-1-yl)phenyl)furan-2-carboxamide. Offered by: GLPBio, Biosynth, MedChemExpress, Ambeed, Chemat. Available pack sizes: 1mg, 10mg, 5mg, 10mM (in 1ml dmso), 25mg, 50mg, 10 mg, 5 mg.
5-cyano-N-[5-(hydroxymethyl)-2-(4-methylpiperidin-1-yl)phenyl]furan-2-carboxamide (CAS 791587-67-2) is a chemical compound with the molecular formula C19H21N3O3 and a molecular weight of 339.4 g/mol. IUPAC name: 5-cyano-N-[5-(hydroxymethyl)-2-(4-methylpiperidin-1-yl)phenyl]furan-2-carboxamide. InChIKey: NNPCFFIJVKYGHR-UHFFFAOYSA-N.
| Molecular formula | C19H21N3O3 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 5-cyano-N-[5-(hydroxymethyl)-2-(4-methylpiperidin-1-yl)phenyl]furan-2-carboxamide |
| InChIKey | NNPCFFIJVKYGHR-UHFFFAOYSA-N |
| SMILES | CC1CCN(CC1)C2=C(C=C(C=C2)CO)NC(=O)C3=CC=C(O3)C#N |
Computed by PubChem (NCBI)