CAS 2099034-38-3 is the registry number for CU-6PMN. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-hydroxy-2-oxo-6-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)chromene-3-carboxylic acid (CAS 2099034-38-3) is a chemical compound with the molecular formula C25H26O5 and a molecular weight of 406.5 g/mol. IUPAC name: 7-hydroxy-2-oxo-6-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)chromene-3-carboxylic acid. InChIKey: UYPOSIGCFZMVDD-UHFFFAOYSA-N.
| Molecular formula | C25H26O5 |
|---|---|
| Molecular weight | 406.5 g/mol |
| IUPAC name | 7-hydroxy-2-oxo-6-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)chromene-3-carboxylic acid |
| InChIKey | UYPOSIGCFZMVDD-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C3=C(C=C4C(=C3)C=C(C(=O)O4)C(=O)O)O)C(CCC2(C)C)(C)C |
Computed by PubChem (NCBI)