CAS 87605-71-8 is the registry number for 3-Geranyloxyemodin. Offered by: Biosynth. Available pack sizes: 2mg, 5mg.
3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1,8-dihydroxy-6-methylanthracene-9,10-dione (CAS 87605-71-8) is a chemical compound with the molecular formula C25H26O5 and a molecular weight of 406.5 g/mol. IUPAC name: 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1,8-dihydroxy-6-methylanthracene-9,10-dione. InChIKey: JVTPNJZXKNTJEF-OVCLIPMQSA-N.
| Molecular formula | C25H26O5 |
|---|---|
| Molecular weight | 406.5 g/mol |
| IUPAC name | 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-1,8-dihydroxy-6-methylanthracene-9,10-dione |
| InChIKey | JVTPNJZXKNTJEF-OVCLIPMQSA-N |
| SMILES | CC1=CC2=C(C(=C1)O)C(=O)C3=C(C2=O)C=C(C=C3O)OC/C=C(\C)/CCC=C(C)C |
Computed by PubChem (NCBI)