Products 955135-37-2
CAS 955135-37-2 is the registry number for 8,3'-Diprenylapigenin. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
5,7-dihydroxy-2-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]-8-(3-methylbut-2-enyl)chromen-4-one (CAS 955135-37-2) is a chemical compound with the molecular formula C25H26O5 and a molecular weight of 406.5 g/mol. IUPAC name: 5,7-dihydroxy-2-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]-8-(3-methylbut-2-enyl)chromen-4-one. InChIKey: NZIDLHYOWGCCCH-UHFFFAOYSA-N.
| Molecular formula | C25H26O5 |
|---|---|
| Molecular weight | 406.5 g/mol |
| IUPAC name | 5,7-dihydroxy-2-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]-8-(3-methylbut-2-enyl)chromen-4-one |
| InChIKey | NZIDLHYOWGCCCH-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C=CC(=C1)C2=CC(=O)C3=C(C=C(C(=C3O2)CC=C(C)C)O)O)O)C |
Computed by PubChem (NCBI)