CAS 2404652-82-8 is the registry number for MT-110, 99.48%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 50 mg, 25 mg.
(3aS)-3a-hydroxy-6,7-dimethyl-1-(2-methylquinolin-6-yl)-2,3-dihydropyrrolo[2,3-b]quinolin-4-one (CAS 2404652-82-8) is a chemical compound with the molecular formula C23H21N3O2 and a molecular weight of 371.4 g/mol. IUPAC name: (3aS)-3a-hydroxy-6,7-dimethyl-1-(2-methylquinolin-6-yl)-2,3-dihydropyrrolo[2,3-b]quinolin-4-one. InChIKey: IBCJNSKHRZXPHX-HSZRJFAPSA-N.
| Molecular formula | C23H21N3O2 |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | (3aS)-3a-hydroxy-6,7-dimethyl-1-(2-methylquinolin-6-yl)-2,3-dihydropyrrolo[2,3-b]quinolin-4-one |
| InChIKey | IBCJNSKHRZXPHX-HSZRJFAPSA-N |
| SMILES | CC1=NC2=C(C=C1)C=C(C=C2)N3CC[C@@]4(C3=NC5=C(C4=O)C=C(C(=C5)C)C)O |
Computed by PubChem (NCBI)