CAS 33495-39-5 is the registry number for GRK6-IN-5. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-[(4-ethoxyanilino)-pyridin-2-ylmethyl]quinolin-8-ol (CAS 33495-39-5) is a chemical compound with the molecular formula C23H21N3O2 and a molecular weight of 371.4 g/mol. IUPAC name: 7-[(4-ethoxyanilino)-pyridin-2-ylmethyl]quinolin-8-ol. InChIKey: YKIYGNLLHIJAIA-UHFFFAOYSA-N.
| Molecular formula | C23H21N3O2 |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | 7-[(4-ethoxyanilino)-pyridin-2-ylmethyl]quinolin-8-ol |
| InChIKey | YKIYGNLLHIJAIA-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)NC(C2=C(C3=C(C=CC=N3)C=C2)O)C4=CC=CC=N4 |
Computed by PubChem (NCBI)