CAS 2101206-70-4 is the registry number for tert-Butyl (4s,5s)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)piperidine-1-carboxylate racemic, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
Tert-butyl (4S,5S)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)piperidine-1-carboxylate (CAS 2101206-70-4) is a chemical compound with the molecular formula C11H19F2NO4 and a molecular weight of 267.27 g/mol. IUPAC name: tert-butyl (4S,5S)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)piperidine-1-carboxylate. InChIKey: VPLQVCYHEZXTMT-YUMQZZPRSA-N.
| Molecular formula | C11H19F2NO4 |
|---|---|
| Molecular weight | 267.27 g/mol |
| IUPAC name | tert-butyl (4S,5S)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)piperidine-1-carboxylate |
| InChIKey | VPLQVCYHEZXTMT-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@@H](C(C1)(F)F)O)CO |
Computed by PubChem (NCBI)