CAS 2350048-17-6 appears in our catalog under these names: (R)-2-((tert-Butoxycarbonyl)amino)-5,5-difluorohexanoic acid, 98%, (R)-2-((tert-Butoxycarbonyl)amino)-5,5-difluorohexanoic acid, 97%, 97%, (2R)-2-(tert-butoxycarbonylamino)-5,5-difluoro-hexanoic acid, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g, 10g, 25g.
(2R)-5,5-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 2350048-17-6) is a chemical compound with the molecular formula C11H19F2NO4 and a molecular weight of 267.27 g/mol. IUPAC name: (2R)-5,5-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: XUUGMBMDWZRWJV-SSDOTTSWSA-N.
| Molecular formula | C11H19F2NO4 |
|---|---|
| Molecular weight | 267.27 g/mol |
| IUPAC name | (2R)-5,5-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | XUUGMBMDWZRWJV-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCC(C)(F)F)C(=O)O |
Computed by PubChem (NCBI)