CAS 2165779-31-5 is the registry number for tert-Butyl (4S,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)piperidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (4S,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)piperidine-1-carboxylate (CAS 2165779-31-5) is a chemical compound with the molecular formula C11H19F2NO4 and a molecular weight of 267.27 g/mol. IUPAC name: tert-butyl (4S,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)piperidine-1-carboxylate. InChIKey: VPLQVCYHEZXTMT-SFYZADRCSA-N.
| Molecular formula | C11H19F2NO4 |
|---|---|
| Molecular weight | 267.27 g/mol |
| IUPAC name | tert-butyl (4S,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)piperidine-1-carboxylate |
| InChIKey | VPLQVCYHEZXTMT-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@@H](C(C1)(F)F)O)CO |
Computed by PubChem (NCBI)