CAS 878009-71-3 is the registry number for (S)-2-((tert-Butoxycarbonyl)amino)-5,5-difluorohexanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-5,5-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 878009-71-3) is a chemical compound with the molecular formula C11H19F2NO4 and a molecular weight of 267.27 g/mol. IUPAC name: (2S)-5,5-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: XUUGMBMDWZRWJV-ZETCQYMHSA-N.
| Molecular formula | C11H19F2NO4 |
|---|---|
| Molecular weight | 267.27 g/mol |
| IUPAC name | (2S)-5,5-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | XUUGMBMDWZRWJV-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(C)(F)F)C(=O)O |
Computed by PubChem (NCBI)