Products 2101218-44-2
CAS 2101218-44-2 appears in our catalog under these names: THK5351 (R enantiomer), 95.62%, THK5351 (R enantiomer). Offered by: MedChemExpress, Chemat. Available pack sizes: 1 mg, 1mg.
(2R)-1-fluoro-3-[2-[6-(methylamino)-3-pyridinyl]quinolin-6-yl]oxypropan-2-ol (CAS 2101218-44-2) is a chemical compound with the molecular formula C18H18FN3O2 and a molecular weight of 327.4 g/mol. IUPAC name: (2R)-1-fluoro-3-[2-[6-(methylamino)-3-pyridinyl]quinolin-6-yl]oxypropan-2-ol. InChIKey: DLVXFZWSPCOWSN-AWEZNQCLSA-N.
| Molecular formula | C18H18FN3O2 |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | (2R)-1-fluoro-3-[2-[6-(methylamino)-3-pyridinyl]quinolin-6-yl]oxypropan-2-ol |
| InChIKey | DLVXFZWSPCOWSN-AWEZNQCLSA-N |
| SMILES | CNC1=NC=C(C=C1)C2=NC3=C(C=C2)C=C(C=C3)OC[C@H](CF)O |
Computed by PubChem (NCBI)