Products 2101321-76-8
CAS 2101321-76-8 appears in our catalog under these names: Kv3 modulator 2, Kv3 modulator 2, Kv3 modulator 2, 99.92%. Offered by: GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 1mg, 25mg, 5mg, 10mg, 25 mg, 5 mg, 10 mg.
(5R)-5-ethyl-3-[5-(7-methylspiro[2H-1-benzofuran-3,1'-cyclopropane]-4-yl)oxy-2-pyridinyl]imidazolidine-2,4-dione (CAS 2101321-76-8) is a chemical compound with the molecular formula C21H21N3O4 and a molecular weight of 379.4 g/mol. IUPAC name: (5R)-5-ethyl-3-[5-(7-methylspiro[2H-1-benzofuran-3,1'-cyclopropane]-4-yl)oxy-2-pyridinyl]imidazolidine-2,4-dione. InChIKey: QRZXUERLZJGJMH-CQSZACIVSA-N.
| Molecular formula | C21H21N3O4 |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | (5R)-5-ethyl-3-[5-(7-methylspiro[2H-1-benzofuran-3,1'-cyclopropane]-4-yl)oxy-2-pyridinyl]imidazolidine-2,4-dione |
| InChIKey | QRZXUERLZJGJMH-CQSZACIVSA-N |
| SMILES | CC[C@@H]1C(=O)N(C(=O)N1)C2=NC=C(C=C2)OC3=C4C(=C(C=C3)C)OCC45CC5 |
Computed by PubChem (NCBI)
Synonyms:
Kv3 modulator 2, orb1709308