CAS 2101636-51-3 appears in our catalog under these names: 3,3''–Diamino–(1,1':4',1''–terphenyl)–4,4''–dicarboxylicacid, 3,3''-Diamino-[1,1':4',1''-terphenyl]-4,4''-dicarboxylic acid, 97%, 97%, 3,3''-Diamino-[1,1':4',1''-terphenyl]-4,4''-dicarboxylic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg.
2-amino-4-[4-(3-amino-4-carboxyphenyl)phenyl]benzoic acid (CAS 2101636-51-3) is a chemical compound with the molecular formula C20H16N2O4 and a molecular weight of 348.4 g/mol. IUPAC name: 2-amino-4-[4-(3-amino-4-carboxyphenyl)phenyl]benzoic acid. InChIKey: TVJAEPMTJSNWLY-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O4 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 2-amino-4-[4-(3-amino-4-carboxyphenyl)phenyl]benzoic acid |
| InChIKey | TVJAEPMTJSNWLY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2)C(=O)O)N)C3=CC(=C(C=C3)C(=O)O)N |
Computed by PubChem (NCBI)