CAS 210165-65-4 is the registry number for rel-(1R,5S,6r)-N,N-Dibenzyl-3-azabicyclo(3.1.0)hexan-6-amine, 98%. Offered by: AmBeed. Available pack sizes: 1g.
(1R,5S)-N,N-dibenzyl-3-azabicyclo[3.1.0]hexan-6-amine (CAS 210165-65-4) is a chemical compound with the molecular formula C19H22N2 and a molecular weight of 278.4 g/mol. IUPAC name: (1R,5S)-N,N-dibenzyl-3-azabicyclo[3.1.0]hexan-6-amine. InChIKey: KDGSINLHKLATBU-DFNIBXOVSA-N.
| Molecular formula | C19H22N2 |
|---|---|
| Molecular weight | 278.4 g/mol |
| IUPAC name | (1R,5S)-N,N-dibenzyl-3-azabicyclo[3.1.0]hexan-6-amine |
| InChIKey | KDGSINLHKLATBU-DFNIBXOVSA-N |
| SMILES | C1[C@@H]2[C@@H](C2N(CC3=CC=CC=C3)CC4=CC=CC=C4)CN1 |
Computed by PubChem (NCBI)