Products 2102179-29-1
CAS 2102179-29-1 appears in our catalog under these names: TRPM8 antagonist 3/ 99.25% (existing batch purity), TRPM8 antagonist 3, TRPM8 antagonist 3, TRPM8 antagonist 3, 99.62%, (4-Hydroxy-2-(2-hydroxyphenyl)thiazol-5-yl)(isoxazolidin-2-yl)methanone, 98%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress, BLDpharm. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 5 mg.
[4-hydroxy-2-(2-hydroxyphenyl)-1,3-thiazol-5-yl]-(1,2-oxazolidin-2-yl)methanone (CAS 2102179-29-1) is a chemical compound with the molecular formula C13H12N2O4S and a molecular weight of 292.31 g/mol. IUPAC name: [4-hydroxy-2-(2-hydroxyphenyl)-1,3-thiazol-5-yl]-(1,2-oxazolidin-2-yl)methanone. InChIKey: BKUQCBLRBYEPFS-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O4S |
|---|---|
| Molecular weight | 292.31 g/mol |
| IUPAC name | [4-hydroxy-2-(2-hydroxyphenyl)-1,3-thiazol-5-yl]-(1,2-oxazolidin-2-yl)methanone |
| InChIKey | BKUQCBLRBYEPFS-UHFFFAOYSA-N |
| SMILES | C1CN(OC1)C(=O)C2=C(N=C(S2)C3=CC=CC=C3O)O |
Computed by PubChem (NCBI)