CAS 2102410-49-9 is the registry number for (S)-3-(PIPERIDIN-3-YI)PROPANOIC ACID HCL, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-[(3S)-piperidin-3-yl]propanoic acid;hydrochloride (CAS 2102410-49-9) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: 3-[(3S)-piperidin-3-yl]propanoic acid;hydrochloride. InChIKey: SKDLOWHMBJEXPF-FJXQXJEOSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | 3-[(3S)-piperidin-3-yl]propanoic acid;hydrochloride |
| InChIKey | SKDLOWHMBJEXPF-FJXQXJEOSA-N |
| SMILES | C1C[C@H](CNC1)CCC(=O)O.Cl |
Computed by PubChem (NCBI)