CAS 2102412-75-7 is the registry number for TERT-BUTYL 4-(ISOPROPYLAMINO)PHENYL(METHYL)CARBAMATE, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl N-methyl-N-[4-(propan-2-ylamino)phenyl]carbamate (CAS 2102412-75-7) is a chemical compound with the molecular formula C15H24N2O2 and a molecular weight of 264.36 g/mol. IUPAC name: tert-butyl N-methyl-N-[4-(propan-2-ylamino)phenyl]carbamate. InChIKey: QKKCWEPWNOYKKH-UHFFFAOYSA-N.
| Molecular formula | C15H24N2O2 |
|---|---|
| Molecular weight | 264.36 g/mol |
| IUPAC name | tert-butyl N-methyl-N-[4-(propan-2-ylamino)phenyl]carbamate |
| InChIKey | QKKCWEPWNOYKKH-UHFFFAOYSA-N |
| SMILES | CC(C)NC1=CC=C(C=C1)N(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)