CAS 21027-72-5 appears in our catalog under these names: H-Gly-phe-pna, 95%, H–Gly–Phe–pNA, H-Gly-L-Phe-pNA, GLY-PHE P-NITROANILIDE, H-Gly-Phe-Pna, ≥98%, ≥98%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Sigma-Aldrich, Chemat. Available pack sizes: 250mg, 100mg, 25mg, 50mg, 500mg, 1g, 5g, 10MG.
2-[(2-aminoacetyl)amino]-N-(4-nitrophenyl)-3-phenylpropanamide (CAS 21027-72-5) is a chemical compound with the molecular formula C17H18N4O4 and a molecular weight of 342.35 g/mol. IUPAC name: 2-[(2-aminoacetyl)amino]-N-(4-nitrophenyl)-3-phenylpropanamide. InChIKey: KNDZCZRECXTRHP-UHFFFAOYSA-N.
| Molecular formula | C17H18N4O4 |
|---|---|
| Molecular weight | 342.35 g/mol |
| IUPAC name | 2-[(2-aminoacetyl)amino]-N-(4-nitrophenyl)-3-phenylpropanamide |
| InChIKey | KNDZCZRECXTRHP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)NC2=CC=C(C=C2)[N+](=O)[O-])NC(=O)CN |
Computed by PubChem (NCBI)