Products 2154342-61-5
CAS 2154342-61-5 is the registry number for Thalidomide-5-piperazine. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(2,6-dioxopiperidin-3-yl)-5-piperazin-1-ylisoindole-1,3-dione (CAS 2154342-61-5) is a chemical compound with the molecular formula C17H18N4O4 and a molecular weight of 342.35 g/mol. IUPAC name: 2-(2,6-dioxopiperidin-3-yl)-5-piperazin-1-ylisoindole-1,3-dione. InChIKey: GFCKACFUYUKAPW-UHFFFAOYSA-N.
| Molecular formula | C17H18N4O4 |
|---|---|
| Molecular weight | 342.35 g/mol |
| IUPAC name | 2-(2,6-dioxopiperidin-3-yl)-5-piperazin-1-ylisoindole-1,3-dione |
| InChIKey | GFCKACFUYUKAPW-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C(C=C3)N4CCNCC4 |
Computed by PubChem (NCBI)