Products 2102729-59-7
CAS 2102729-59-7 is the registry number for 4,4-Dimethyl-2-phenylpent-2-enoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(Z)-4,4-dimethyl-2-phenylpent-2-enoic acid (CAS 2102729-59-7) is a chemical compound with the molecular formula C13H16O2 and a molecular weight of 204.26 g/mol. IUPAC name: (Z)-4,4-dimethyl-2-phenylpent-2-enoic acid. InChIKey: UBLVOIAHOJGSIY-LUAWRHEFSA-N.
| Molecular formula | C13H16O2 |
|---|---|
| Molecular weight | 204.26 g/mol |
| IUPAC name | (Z)-4,4-dimethyl-2-phenylpent-2-enoic acid |
| InChIKey | UBLVOIAHOJGSIY-LUAWRHEFSA-N |
| SMILES | CC(C)(C)/C=C(/C1=CC=CC=C1)\C(=O)O |
Computed by PubChem (NCBI)