CAS 2103-57-3 appears in our catalog under these names: 2,3,4-Trimethoxybenzaldehyde, min. 95 %, 2 kg, Trimetazidine EP Impurity C, 2,3,4-Trimethoxybenzaldehyde, 2,3,4-Trimethoxybenzaldehyde, >95% (HPLC), 2,3,4–Trimethoxybenzaldehyde. Offered by: Roth, Chemat Brand, Mikromol, TRC, GLPBio. Available pack sizes: 2kg, on request, 4x25mg, 25mg, 100mg, 5g, 100g, 500g.
2,3,4-trimethoxybenzaldehyde (CAS 2103-57-3) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. IUPAC name: 2,3,4-trimethoxybenzaldehyde. InChIKey: UCTUXUGXIFRVGX-UHFFFAOYSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 2,3,4-trimethoxybenzaldehyde |
| InChIKey | UCTUXUGXIFRVGX-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C=O)OC)OC |
Computed by PubChem (NCBI)