Products 210347-62-9
CAS 210347-62-9 is the registry number for For-Val-Val-OH. Offered by: Creative Peptides. Available pack sizes: on request.
(2S)-2-[[(2S)-2-formamido-3-methylbutanoyl]amino]-3-methylbutanoic acid (CAS 210347-62-9) is a chemical compound with the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. IUPAC name: (2S)-2-[[(2S)-2-formamido-3-methylbutanoyl]amino]-3-methylbutanoic acid. InChIKey: XGQOCGNBJHJUET-IUCAKERBSA-N.
| Molecular formula | C11H20N2O4 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-formamido-3-methylbutanoyl]amino]-3-methylbutanoic acid |
| InChIKey | XGQOCGNBJHJUET-IUCAKERBSA-N |
| SMILES | CC(C)[C@@H](C(=O)N[C@@H](C(C)C)C(=O)O)NC=O |
Computed by PubChem (NCBI)