Products 2103873-47-6
CAS 2103873-47-6 is the registry number for Ethyl 5-(trifluoromethyl)pyrazine-2-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 5-(trifluoromethyl)pyrazine-2-carboxylate (CAS 2103873-47-6) is a chemical compound with the molecular formula C8H7F3N2O2 and a molecular weight of 220.15 g/mol. IUPAC name: ethyl 5-(trifluoromethyl)pyrazine-2-carboxylate. InChIKey: LUMVBUHAHPBPQA-UHFFFAOYSA-N.
| Molecular formula | C8H7F3N2O2 |
|---|---|
| Molecular weight | 220.15 g/mol |
| IUPAC name | ethyl 5-(trifluoromethyl)pyrazine-2-carboxylate |
| InChIKey | LUMVBUHAHPBPQA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(C=N1)C(F)(F)F |
Computed by PubChem (NCBI)