Products 2103908-39-8
CAS 2103908-39-8 is the registry number for 3-(4-Bromo-3-chloro-2-fluorophenyl)-3-oxetanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg.
3-(4-bromo-3-chloro-2-fluorophenyl)oxetan-3-ol (CAS 2103908-39-8) is a chemical compound with the molecular formula C9H7BrClFO2 and a molecular weight of 281.50 g/mol. IUPAC name: 3-(4-bromo-3-chloro-2-fluorophenyl)oxetan-3-ol. InChIKey: JQEBXENJDRISSN-UHFFFAOYSA-N.
| Molecular formula | C9H7BrClFO2 |
|---|---|
| Molecular weight | 281.50 g/mol |
| IUPAC name | 3-(4-bromo-3-chloro-2-fluorophenyl)oxetan-3-ol |
| InChIKey | JQEBXENJDRISSN-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(C2=C(C(=C(C=C2)Br)Cl)F)O |
Computed by PubChem (NCBI)