CAS 2105144-00-9 is the registry number for Ethyl 2-bromo-4-cyclopropyl-5-thiazolecarboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 2-bromo-4-cyclopropyl-1,3-thiazole-5-carboxylate (CAS 2105144-00-9) is a chemical compound with the molecular formula C9H10BrNO2S and a molecular weight of 276.15 g/mol. IUPAC name: ethyl 2-bromo-4-cyclopropyl-1,3-thiazole-5-carboxylate. InChIKey: YWXXTGJRXNTUSE-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2S |
|---|---|
| Molecular weight | 276.15 g/mol |
| IUPAC name | ethyl 2-bromo-4-cyclopropyl-1,3-thiazole-5-carboxylate |
| InChIKey | YWXXTGJRXNTUSE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)Br)C2CC2 |
Computed by PubChem (NCBI)