Products 2105319-44-4
CAS 2105319-44-4 is the registry number for ethyl 6-bromo-4-methoxy-1H-indole-2-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Ethyl 6-bromo-4-methoxy-1H-indole-2-carboxylate (CAS 2105319-44-4) is a chemical compound with the molecular formula C12H12BrNO3 and a molecular weight of 298.13 g/mol. IUPAC name: ethyl 6-bromo-4-methoxy-1H-indole-2-carboxylate. InChIKey: DGWGBSXPGBDFMS-UHFFFAOYSA-N.
| Molecular formula | C12H12BrNO3 |
|---|---|
| Molecular weight | 298.13 g/mol |
| IUPAC name | ethyl 6-bromo-4-methoxy-1H-indole-2-carboxylate |
| InChIKey | DGWGBSXPGBDFMS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1)C=C(C=C2OC)Br |
Computed by PubChem (NCBI)