Products 2105467-16-9
CAS 2105467-16-9 is the registry number for Ethyl 2-amino-4-bromo-3,5-difluorobenzoate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-amino-4-bromo-3,5-difluorobenzoate (CAS 2105467-16-9) is a chemical compound with the molecular formula C9H8BrF2NO2 and a molecular weight of 280.07 g/mol. IUPAC name: ethyl 2-amino-4-bromo-3,5-difluorobenzoate. InChIKey: IZWMBXVQFIBJPK-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF2NO2 |
|---|---|
| Molecular weight | 280.07 g/mol |
| IUPAC name | ethyl 2-amino-4-bromo-3,5-difluorobenzoate |
| InChIKey | IZWMBXVQFIBJPK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1N)F)Br)F |
Computed by PubChem (NCBI)