CAS 2901105-85-7 is the registry number for 4-bromo-2,3-difluoro-N-methoxy-N-methylbenzamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-bromo-2,3-difluoro-N-methoxy-N-methylbenzamide (CAS 2901105-85-7) is a chemical compound with the molecular formula C9H8BrF2NO2 and a molecular weight of 280.07 g/mol. IUPAC name: 4-bromo-2,3-difluoro-N-methoxy-N-methylbenzamide. InChIKey: BURFEVVOHSFQKQ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF2NO2 |
|---|---|
| Molecular weight | 280.07 g/mol |
| IUPAC name | 4-bromo-2,3-difluoro-N-methoxy-N-methylbenzamide |
| InChIKey | BURFEVVOHSFQKQ-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C1=C(C(=C(C=C1)Br)F)F)OC |
Computed by PubChem (NCBI)