CAS 2106744-33-4 is the registry number for Ethyl (3-bromo-2,4-difluorophenyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl N-(3-bromo-2,4-difluorophenyl)carbamate (CAS 2106744-33-4) is a chemical compound with the molecular formula C9H8BrF2NO2 and a molecular weight of 280.07 g/mol. IUPAC name: ethyl N-(3-bromo-2,4-difluorophenyl)carbamate. InChIKey: YGWPMLQIVHTWAC-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF2NO2 |
|---|---|
| Molecular weight | 280.07 g/mol |
| IUPAC name | ethyl N-(3-bromo-2,4-difluorophenyl)carbamate |
| InChIKey | YGWPMLQIVHTWAC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NC1=C(C(=C(C=C1)F)Br)F |
Computed by PubChem (NCBI)