CAS 2106477-57-8 appears in our catalog under these names: 2-tert-Butyl 1-methyl 2-azabicyclo[4.1.0]heptane-1,2-dicarboxylate, 95%, 2-(tert-butyl) 1-methyl 2-azabicyclo(4.1.0)heptane-1,2-dicarboxylate, 97%, 2–tert–Butyl 1–methyl 2–azabicyclo(4·1·0)heptane–1,2–dicarboxylate, 2-tert-Butyl 1-methyl 2-azabicyclo[4.1.0]heptane-1,2-dicarboxylate, 97%, 97%, 2-tert-Butyl 1-methyl 2-azabicyclo[4.1.0]heptane-1,2-dicarboxylate, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 5g, 250mg, 500mg.
2-O-tert-butyl 1-O-methyl 2-azabicyclo[4.1.0]heptane-1,2-dicarboxylate (CAS 2106477-57-8) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: 2-O-tert-butyl 1-O-methyl 2-azabicyclo[4.1.0]heptane-1,2-dicarboxylate. InChIKey: MTYIZWZZJUYXRD-UHFFFAOYSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | 2-O-tert-butyl 1-O-methyl 2-azabicyclo[4.1.0]heptane-1,2-dicarboxylate |
| InChIKey | MTYIZWZZJUYXRD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2C1(C2)C(=O)OC |
Computed by PubChem (NCBI)