CAS 2106575-50-0 appears in our catalog under these names: 5-(5-Fluoro-2-methoxyphenyl)-3-methyl-1h-pyrrole-2-carboxylic acid, 95%, 5–(5–Fluoro–2–methoxyphenyl)–3–methyl–1H–pyrrole–2–carboxylic acid, 5-(5-Fluoro-2-methoxyphenyl)-3-methyl-1H-pyrrole-2-carboxylic acid 95%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 5g, 1g, 250mg, 100mg, 50mg.
5-(5-fluoro-2-methoxyphenyl)-3-methyl-1H-pyrrole-2-carboxylic acid (CAS 2106575-50-0) is a chemical compound with the molecular formula C13H12FNO3 and a molecular weight of 249.24 g/mol. IUPAC name: 5-(5-fluoro-2-methoxyphenyl)-3-methyl-1H-pyrrole-2-carboxylic acid. InChIKey: OXSGXEJFQRMAII-UHFFFAOYSA-N.
| Molecular formula | C13H12FNO3 |
|---|---|
| Molecular weight | 249.24 g/mol |
| IUPAC name | 5-(5-fluoro-2-methoxyphenyl)-3-methyl-1H-pyrrole-2-carboxylic acid |
| InChIKey | OXSGXEJFQRMAII-UHFFFAOYSA-N |
| SMILES | CC1=C(NC(=C1)C2=C(C=CC(=C2)F)OC)C(=O)O |
Computed by PubChem (NCBI)