CAS 51655-76-6 is the registry number for 4-Fluoro-3-methylphenethyl oxazole-4-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(4-fluorophenyl)-5-methyl-1,3-oxazole-4-carboxylate (CAS 51655-76-6) is a chemical compound with the molecular formula C13H12FNO3 and a molecular weight of 249.24 g/mol. IUPAC name: ethyl 2-(4-fluorophenyl)-5-methyl-1,3-oxazole-4-carboxylate. InChIKey: IZAQHUBRLSKBES-UHFFFAOYSA-N.
| Molecular formula | C13H12FNO3 |
|---|---|
| Molecular weight | 249.24 g/mol |
| IUPAC name | ethyl 2-(4-fluorophenyl)-5-methyl-1,3-oxazole-4-carboxylate |
| InChIKey | IZAQHUBRLSKBES-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(OC(=N1)C2=CC=C(C=C2)F)C |
Computed by PubChem (NCBI)