CAS 477933-12-3 is the registry number for 1-(2-Cyclopropylethyl)-6-fluorobenzo(d)(1,3)oxazine-2,4-dione. Offered by: TRC. Available pack sizes: 500mg, 50mg.
1-(2-cyclopropylethyl)-6-fluoro-3,1-benzoxazine-2,4-dione (CAS 477933-12-3) is a chemical compound with the molecular formula C13H12FNO3 and a molecular weight of 249.24 g/mol. IUPAC name: 1-(2-cyclopropylethyl)-6-fluoro-3,1-benzoxazine-2,4-dione. InChIKey: GHLUJHVVLMJROO-UHFFFAOYSA-N.
| Molecular formula | C13H12FNO3 |
|---|---|
| Molecular weight | 249.24 g/mol |
| IUPAC name | 1-(2-cyclopropylethyl)-6-fluoro-3,1-benzoxazine-2,4-dione |
| InChIKey | GHLUJHVVLMJROO-UHFFFAOYSA-N |
| SMILES | C1CC1CCN2C3=C(C=C(C=C3)F)C(=O)OC2=O |
Computed by PubChem (NCBI)