Products 2108054-67-5

CAS 2108054-67-5 is the registry number for Ethyl 5,6-dihydro-4H-cyclopenta[c]thiophene-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 5,6-dihydro-4H-cyclopenta[c]thiophene-3-carboxylate (CAS 2108054-67-5) is a chemical compound with the molecular formula C10H12O2S and a molecular weight of 196.27 g/mol. IUPAC name: ethyl 5,6-dihydro-4H-cyclopenta[c]thiophene-3-carboxylate. InChIKey: BQZVUNGFLFYOQG-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12O2S
Molecular weight196.27 g/mol
IUPAC nameethyl 5,6-dihydro-4H-cyclopenta[c]thiophene-3-carboxylate
InChIKeyBQZVUNGFLFYOQG-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C2CCCC2=CS1

Computed by PubChem (NCBI)