Products 210824-10-5
CAS 210824-10-5 appears in our catalog under these names: (S)–2–Amino–4–oxo–4–(tritylamino)butanoic acid hydrate, H-L-Asn(Trt)-OH*H2O, H-Asn(Trt)-OH.H2O 95%, N4-Trityl-L-asparagine hydrate, 95%, 95%, N4-Trityl-L-asparagine (hydrate), 97%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 5g, 1g, 10g.
(2S)-2-amino-4-oxo-4-(tritylamino)butanoic acid;hydrate (CAS 210824-10-5) is a chemical compound with the molecular formula C23H24N2O4 and a molecular weight of 392.4 g/mol. IUPAC name: (2S)-2-amino-4-oxo-4-(tritylamino)butanoic acid;hydrate. InChIKey: LGSZZNPDVYLXAC-BDQAORGHSA-N.
| Molecular formula | C23H24N2O4 |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | (2S)-2-amino-4-oxo-4-(tritylamino)butanoic acid;hydrate |
| InChIKey | LGSZZNPDVYLXAC-BDQAORGHSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)NC(=O)C[C@@H](C(=O)O)N.O |
Computed by PubChem (NCBI)
Synonyms:
(S)-2-Amino-4-oxo-4-(tritylamino)butanoic acid hydrate, N4-Trityl-L-asparagine hydrate, H-Asn(trt)-OH hydrate, N'-TRITYL-L-ASPARAGINE HYDRATE, (2S)-2-amino-4-oxo-4-(tritylamino)butanoic acid;hydrate, H-Asn(Trt)-OH.H20, (2S)-2-amino-3-[(triphenylmethyl)carbamoyl]propanoic acid hydrate, N4-Trityl-L-asparagine (hydrate), 132388-58-0(Anhydrous CAS), H-Asn(Trt)-OH inverted exclamation mark currencyH2O