CAS 210827-20-6 appears in our catalog under these names: N,N-Dimethyl-3-sulfamoylbenzamide, 95%, N,N-Dimethyl-3-sulfamoylbenzamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
N,N-dimethyl-3-sulfamoylbenzamide (CAS 210827-20-6) is a chemical compound with the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. IUPAC name: N,N-dimethyl-3-sulfamoylbenzamide. InChIKey: VFVPHZGXBDBQCG-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O3S |
|---|---|
| Molecular weight | 228.27 g/mol |
| IUPAC name | N,N-dimethyl-3-sulfamoylbenzamide |
| InChIKey | VFVPHZGXBDBQCG-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=CC=C1)S(=O)(=O)N |
Computed by PubChem (NCBI)