CAS 2108550-78-1 appears in our catalog under these names: 1-Boc-4-hydrazinylpiperidine oxalate, 95%, tert-Butyl 4-hydrazinylpiperidine-1-carboxylate oxalate 98%, tert-Butyl 4-hydrazinylpiperidine-1-carboxylate oxalate, 98%, 98%, oxalic acid, tert-butyl 4-hydrazinylpiperidine-1-carboxylate, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 25g.
Tert-butyl 4-hydrazinylpiperidine-1-carboxylate;oxalic acid (CAS 2108550-78-1) is a chemical compound with the molecular formula C12H23N3O6 and a molecular weight of 305.33 g/mol. IUPAC name: tert-butyl 4-hydrazinylpiperidine-1-carboxylate;oxalic acid. InChIKey: ZULXWWCUXZJBKD-UHFFFAOYSA-N.
| Molecular formula | C12H23N3O6 |
|---|---|
| Molecular weight | 305.33 g/mol |
| IUPAC name | tert-butyl 4-hydrazinylpiperidine-1-carboxylate;oxalic acid |
| InChIKey | ZULXWWCUXZJBKD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)NN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)