CAS 75658-82-1 is the registry number for N6-((2R,5S)-5-Amino-5-carboxy-2-hydroxypentyl)-5-oxo-L-lysine (Impurity). Offered by: TRC. Available pack sizes: 25mg.
(2S,5R)-2-amino-6-[[(5S)-5-amino-5-carboxy-2-oxopentyl]amino]-5-hydroxyhexanoic acid (CAS 75658-82-1) is a chemical compound with the molecular formula C12H23N3O6 and a molecular weight of 305.33 g/mol. IUPAC name: (2S,5R)-2-amino-6-[[(5S)-5-amino-5-carboxy-2-oxopentyl]amino]-5-hydroxyhexanoic acid. InChIKey: DURWCOJUBQZWSY-JEZHCXPESA-N.
| Molecular formula | C12H23N3O6 |
|---|---|
| Molecular weight | 305.33 g/mol |
| IUPAC name | (2S,5R)-2-amino-6-[[(5S)-5-amino-5-carboxy-2-oxopentyl]amino]-5-hydroxyhexanoic acid |
| InChIKey | DURWCOJUBQZWSY-JEZHCXPESA-N |
| SMILES | C(C[C@@H](C(=O)O)N)[C@H](CNCC(=O)CC[C@@H](C(=O)O)N)O |
Computed by PubChem (NCBI)