CAS 84794-58-1 appears in our catalog under these names: H–Ala–Ala–Ala–OMe, H-Ala-Ala-Ala-OMe, H-Ala-Ala-Ala-OMe acetate salt. Offered by: GLPBio, Creative Peptides, Biosynth. Available pack sizes: 1g, on request, 5g, 0,5g.
Acetic acid;methyl (2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]propanoate (CAS 84794-58-1) is a chemical compound with the molecular formula C12H23N3O6 and a molecular weight of 305.33 g/mol. IUPAC name: acetic acid;methyl (2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]propanoate. InChIKey: OIXCZCRTUYQFFJ-MKXDVQRUSA-N.
| Molecular formula | C12H23N3O6 |
|---|---|
| Molecular weight | 305.33 g/mol |
| IUPAC name | acetic acid;methyl (2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]propanoate |
| InChIKey | OIXCZCRTUYQFFJ-MKXDVQRUSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)OC)N.CC(=O)O |
Computed by PubChem (NCBI)