Products 21086-87-3
CAS 21086-87-3 is the registry number for (4-Methylphenyl)methyl 4-methylbenzoate, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g.
(4-methylphenyl)methyl 4-methylbenzoate (CAS 21086-87-3) is a chemical compound with the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. IUPAC name: (4-methylphenyl)methyl 4-methylbenzoate. InChIKey: JSMHXVURHYHQGT-UHFFFAOYSA-N.
| Molecular formula | C16H16O2 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | (4-methylphenyl)methyl 4-methylbenzoate |
| InChIKey | JSMHXVURHYHQGT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)COC(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)